C25H24Br2O6 — CID 67076564
methyl 4-bromo-3-hydroxybenzoate;methyl 4-bromo-3-[2-(3-methylphenyl)ethoxy]benzoate (PubChem CID 67076564) has the molecular formula C25H24Br2O6 and a molecular weight of 580.27 g/mol. Its IUPAC name is methyl 4-bromo-3-hydroxybenzoate;methyl 4-bromo-3-[2-(3-methylphenyl)ethoxy]benzoate.
| Compound Name | methyl 4-bromo-3-hydroxybenzoate;methyl 4-bromo-3-[2-(3-methylphenyl)ethoxy]benzoate |
|---|---|
| PubChem CID | 67076564 |
| Molecular Formula | C25H24Br2O6 |
| Molecular Weight | 580.27 g/mol |
| Exact Mass | 577.99 |
| IUPAC Name | methyl 4-bromo-3-hydroxybenzoate;methyl 4-bromo-3-[2-(3-methylphenyl)ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(Br)c(O)c1.COC(=O)c1ccc(Br)c(OCCc2cccc(C)c2)c1 |
| InChI | InChI=1S/C17H17BrO3.C8H7BrO3/c1-12-4-3-5-13(10-12)8-9-21-16-11-14(17(19)20-2)6-7-15(16)18;1-12-8(11)5-2-3-6(9)7(10)4-5/h3-7,10-11H,8-9H2,1-2H3;2-4,10H,1H3 |
| InChIKey | OPMIICYXYXUYPN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.27 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |