C26H31NO5 — CID 67170182
methyl 1-[[4-methoxy-3-[2-(3-methylphenyl)ethoxy]benzoyl]amino]-4-methylidenecyclohexane-1-carboxylate (PubChem CID 67170182) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is methyl 1-[[4-methoxy-3-[2-(3-methylphenyl)ethoxy]benzoyl]amino]-4-methylidenecyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[4-methoxy-3-[2-(3-methylphenyl)ethoxy]benzoyl]amino]-4-methylidenecyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67170182 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | methyl 1-[[4-methoxy-3-[2-(3-methylphenyl)ethoxy]benzoyl]amino]-4-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1CCC(NC(=O)c2ccc(OC)c(OCCc3cccc(C)c3)c2)(C(=O)OC)CC1 |
| InChI | InChI=1S/C26H31NO5/c1-18-10-13-26(14-11-18,25(29)31-4)27-24(28)21-8-9-22(30-3)23(17-21)32-15-12-20-7-5-6-19(2)16-20/h5-9,16-17H,1,10-15H2,2-4H3,(H,27,28) |
| InChIKey | KSVNTTAZKVCOHN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|