C27H29NO4 — CID 129147431
methyl 2-[4-methoxy-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylate (PubChem CID 129147431) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is methyl 2-[4-methoxy-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylate.
| Compound Name | methyl 2-[4-methoxy-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 129147431 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | methyl 2-[4-methoxy-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylate |
| SMILES | COC(=O)C1(Nc2ccc(OC)c(OCCc3cccc(C)c3)c2)Cc2ccccc2C1 |
| InChI | InChI=1S/C27H29NO4/c1-19-7-6-8-20(15-19)13-14-32-25-16-23(11-12-24(25)30-2)28-27(26(29)31-3)17-21-9-4-5-10-22(21)18-27/h4-12,15-16,28H,13-14,17-18H2,1-3H3 |
| InChIKey | WQYYGQHULILCSO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|