C27H30N2O3 — CID 129146963
2-[4-(dimethylamino)-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylic acid (PubChem CID 129146963) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 2-[4-(dimethylamino)-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 129146963 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-[4-(dimethylamino)-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylic acid |
| SMILES | Cc1cccc(CCOc2cc(NC3(C(=O)O)Cc4ccccc4C3)ccc2N(C)C)c1 |
| InChI | InChI=1S/C27H30N2O3/c1-19-7-6-8-20(15-19)13-14-32-25-16-23(11-12-24(25)29(2)3)28-27(26(30)31)17-21-9-4-5-10-22(21)18-27/h4-12,15-16,28H,13-14,17-18H2,1-3H3,(H,30,31) |
| InChIKey | QKUSXWHNVGAAST-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|