C29H33NO5 — CID 129147362
2-[3-[2-[3-(2-hydroxy-2-methylpropyl)phenyl]ethoxy]-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid (PubChem CID 129147362) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-[3-[2-[3-(2-hydroxy-2-methylpropyl)phenyl]ethoxy]-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 2-[3-[2-[3-(2-hydroxy-2-methylpropyl)phenyl]ethoxy]-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 129147362 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 2-[3-[2-[3-(2-hydroxy-2-methylpropyl)phenyl]ethoxy]-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid |
| SMILES | COc1ccc(NC2(C(=O)O)Cc3ccccc3C2)cc1OCCc1cccc(CC(C)(C)O)c1 |
| InChI | InChI=1S/C29H33NO5/c1-28(2,33)17-21-8-6-7-20(15-21)13-14-35-26-16-24(11-12-25(26)34-3)30-29(27(31)32)18-22-9-4-5-10-23(22)19-29/h4-12,15-16,30,33H,13-14,17-19H2,1-3H3,(H,31,32) |
| InChIKey | RXRKOXIFSADVOH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|