C32H31NO4 — CID 143888577
2-[3-[2-(3-methylphenyl)ethoxy]-4-phenylmethoxyanilino]-1,3-dihydroindene-2-carboxylic acid (PubChem CID 143888577) has the molecular formula C32H31NO4 and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-[3-[2-(3-methylphenyl)ethoxy]-4-phenylmethoxyanilino]-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 2-[3-[2-(3-methylphenyl)ethoxy]-4-phenylmethoxyanilino]-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 143888577 |
| Molecular Formula | C32H31NO4 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 2-[3-[2-(3-methylphenyl)ethoxy]-4-phenylmethoxyanilino]-1,3-dihydroindene-2-carboxylic acid |
| SMILES | Cc1cccc(CCOc2cc(NC3(C(=O)O)Cc4ccccc4C3)ccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H31NO4/c1-23-8-7-11-24(18-23)16-17-36-30-19-28(14-15-29(30)37-22-25-9-3-2-4-10-25)33-32(31(34)35)20-26-12-5-6-13-27(26)21-32/h2-15,18-19,33H,16-17,20-22H2,1H3,(H,34,35) |
| InChIKey | HVNLKGRGYQVGBE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|