C27H27NO5S — CID 129111090
[2-[[3-[2-(3-methylphenyl)ethoxy]-4-methylsulfanylbenzoyl]amino]-1,3-dihydroinden-2-yl] hydrogen carbonate (PubChem CID 129111090) has the molecular formula C27H27NO5S and a molecular weight of 477.58 g/mol. Its IUPAC name is [2-[[3-[2-(3-methylphenyl)ethoxy]-4-methylsulfanylbenzoyl]amino]-1,3-dihydroinden-2-yl] hydrogen carbonate.
| Compound Name | [2-[[3-[2-(3-methylphenyl)ethoxy]-4-methylsulfanylbenzoyl]amino]-1,3-dihydroinden-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 129111090 |
| Molecular Formula | C27H27NO5S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | [2-[[3-[2-(3-methylphenyl)ethoxy]-4-methylsulfanylbenzoyl]amino]-1,3-dihydroinden-2-yl] hydrogen carbonate |
| SMILES | CSc1ccc(C(=O)NC2(OC(=O)O)Cc3ccccc3C2)cc1OCCc1cccc(C)c1 |
| InChI | InChI=1S/C27H27NO5S/c1-18-6-5-7-19(14-18)12-13-32-23-15-20(10-11-24(23)34-2)25(29)28-27(33-26(30)31)16-21-8-3-4-9-22(21)17-27/h3-11,14-15H,12-13,16-17H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | QKQYHUCJYJMFPO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|