C27H22Cl3NO5 — CID 67080313
6-chloro-7-[4-[4-(2,4-dichlorophenyl)but-3-enylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid (PubChem CID 67080313) has the molecular formula C27H22Cl3NO5 and a molecular weight of 546.83 g/mol. Its IUPAC name is 6-chloro-7-[4-[4-(2,4-dichlorophenyl)but-3-enylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid.
| Compound Name | 6-chloro-7-[4-[4-(2,4-dichlorophenyl)but-3-enylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid |
|---|---|
| PubChem CID | 67080313 |
| Molecular Formula | C27H22Cl3NO5 |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | 6-chloro-7-[4-[4-(2,4-dichlorophenyl)but-3-enylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid |
| SMILES | O=C(NCCC=Cc1ccc(Cl)cc1Cl)c1ccc(Oc2cc3c(cc2Cl)C(C(=O)O)CCO3)cc1 |
| InChI | InChI=1S/C27H22Cl3NO5/c28-18-7-4-16(22(29)13-18)3-1-2-11-31-26(32)17-5-8-19(9-6-17)36-25-15-24-21(14-23(25)30)20(27(33)34)10-12-35-24/h1,3-9,13-15,20H,2,10-12H2,(H,31,32)(H,33,34) |
| InChIKey | VUOCUNRXTOOPIP-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|