C12H18FN2O3P — CID 67080586
[benzyl-(4-fluoropiperidin-3-yl)amino]phosphonic acid (PubChem CID 67080586) has the molecular formula C12H18FN2O3P and a molecular weight of 288.26 g/mol. Its IUPAC name is [benzyl-(4-fluoropiperidin-3-yl)amino]phosphonic acid.
| Compound Name | [benzyl-(4-fluoropiperidin-3-yl)amino]phosphonic acid |
|---|---|
| PubChem CID | 67080586 |
| Molecular Formula | C12H18FN2O3P |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [benzyl-(4-fluoropiperidin-3-yl)amino]phosphonic acid |
| SMILES | O=P(O)(O)N(Cc1ccccc1)C1CNCCC1F |
| InChI | InChI=1S/C12H18FN2O3P/c13-11-6-7-14-8-12(11)15(19(16,17)18)9-10-4-2-1-3-5-10/h1-5,11-12,14H,6-9H2,(H2,16,17,18) |
| InChIKey | NYHLYHIXZPQHTO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|