C25H24N4O2S2 — CID 67081148
N-[[(1S,3S,5S)-2-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]pyrrolo[2,1-b][1,3]thiazole-7-carboxamide (PubChem CID 67081148) has the molecular formula C25H24N4O2S2 and a molecular weight of 476.63 g/mol. Its IUPAC name is N-[[(1S,3S,5S)-2-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]pyrrolo[2,1-b][1,3]thiazole-7-carboxamide.
| Compound Name | N-[[(1S,3S,5S)-2-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]pyrrolo[2,1-b][1,3]thiazole-7-carboxamide |
|---|---|
| PubChem CID | 67081148 |
| Molecular Formula | C25H24N4O2S2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[[(1S,3S,5S)-2-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]pyrrolo[2,1-b][1,3]thiazole-7-carboxamide |
| SMILES | Cc1cccc(-c2sc(C)nc2C(=O)N2[C@H](CNC(=O)c3ccn4ccsc34)C[C@@H]3C[C@@H]32)c1 |
| InChI | InChI=1S/C25H24N4O2S2/c1-14-4-3-5-16(10-14)22-21(27-15(2)33-22)24(31)29-18(11-17-12-20(17)29)13-26-23(30)19-6-7-28-8-9-32-25(19)28/h3-10,17-18,20H,11-13H2,1-2H3,(H,26,30)/t17-,18+,20+/m1/s1 |
| InChIKey | KRVUMBRVXLUWAW-HBFSDRIKSA-N |
| XLogP | 4.77 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |