C25H24N4O3S2 — CID 68633469
pyrrolo[2,1-b][1,3]thiazol-7-yl N-[[(1S,2S,5R)-3-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]carbamate (PubChem CID 68633469) has the molecular formula C25H24N4O3S2 and a molecular weight of 492.63 g/mol. Its IUPAC name is pyrrolo[2,1-b][1,3]thiazol-7-yl N-[[(1S,2S,5R)-3-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]carbamate.
| Compound Name | pyrrolo[2,1-b][1,3]thiazol-7-yl N-[[(1S,2S,5R)-3-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 68633469 |
| Molecular Formula | C25H24N4O3S2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | pyrrolo[2,1-b][1,3]thiazol-7-yl N-[[(1S,2S,5R)-3-[2-methyl-5-(3-methylphenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]carbamate |
| SMILES | Cc1cccc(-c2sc(C)nc2C(=O)N2C[C@@H]3C[C@@H]3[C@H]2CNC(=O)Oc2ccn3ccsc23)c1 |
| InChI | InChI=1S/C25H24N4O3S2/c1-14-4-3-5-16(10-14)22-21(27-15(2)34-22)23(30)29-13-17-11-18(17)19(29)12-26-25(31)32-20-6-7-28-8-9-33-24(20)28/h3-10,17-19H,11-13H2,1-2H3,(H,26,31)/t17-,18-,19+/m0/s1 |
| InChIKey | PGDCQGRRSHKACU-GBESFXJTSA-N |
| XLogP | 4.99 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |