C20H36O2 — CID 67084275
3-[2,4-bis(2-methylbutan-2-yl)cyclohexyl]-2-methylprop-2-enoic acid (PubChem CID 67084275) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 3-[2,4-bis(2-methylbutan-2-yl)cyclohexyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2,4-bis(2-methylbutan-2-yl)cyclohexyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67084275 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 3-[2,4-bis(2-methylbutan-2-yl)cyclohexyl]-2-methylprop-2-enoic acid |
| SMILES | CCC(C)(C)C1CCC(C=C(C)C(=O)O)C(C(C)(C)CC)C1 |
| InChI | InChI=1S/C20H36O2/c1-8-19(4,5)16-11-10-15(12-14(3)18(21)22)17(13-16)20(6,7)9-2/h12,15-17H,8-11,13H2,1-7H3,(H,21,22) |
| InChIKey | OLDGHUIMPZBKMW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|