C16H14N4O2S2 — CID 67084318
3-[4-(methylaminomethyl)-1-thiophen-2-ylsulfonylpyrrol-2-yl]pyridine-2-carbonitrile (PubChem CID 67084318) has the molecular formula C16H14N4O2S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 3-[4-(methylaminomethyl)-1-thiophen-2-ylsulfonylpyrrol-2-yl]pyridine-2-carbonitrile.
| Compound Name | 3-[4-(methylaminomethyl)-1-thiophen-2-ylsulfonylpyrrol-2-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 67084318 |
| Molecular Formula | C16H14N4O2S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 3-[4-(methylaminomethyl)-1-thiophen-2-ylsulfonylpyrrol-2-yl]pyridine-2-carbonitrile |
| SMILES | CNCc1cc(-c2cccnc2C#N)n(S(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C16H14N4O2S2/c1-18-10-12-8-15(13-4-2-6-19-14(13)9-17)20(11-12)24(21,22)16-5-3-7-23-16/h2-8,11,18H,10H2,1H3 |
| InChIKey | MVCUMQSHJNSIKI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |