C24H32N2O5 — CID 67084960
tert-butyl 4-[(3aS,6aR)-5-benzoyloxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-oxopiperazine-1-carboxylate (PubChem CID 67084960) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is tert-butyl 4-[(3aS,6aR)-5-benzoyloxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3aS,6aR)-5-benzoyloxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 67084960 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | tert-butyl 4-[(3aS,6aR)-5-benzoyloxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-oxopiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2C[C@H]3CC(OC(=O)c4ccccc4)C[C@H]3C2)C(=O)C1 |
| InChI | InChI=1S/C24H32N2O5/c1-24(2,3)31-23(29)25-9-10-26(21(27)15-25)19-11-17-13-20(14-18(17)12-19)30-22(28)16-7-5-4-6-8-16/h4-8,17-20H,9-15H2,1-3H3/t17-,18+,19?,20? |
| InChIKey | BLTZILOAQJVIJD-VCWRXUFXSA-N |
| XLogP | 3.48 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |