C24H33NO6 — CID 164510959
tert-butyl 4-[4-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-2-yl]benzoyl]oxypiperidine-1-carboxylate (PubChem CID 164510959) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-2-yl]benzoyl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-2-yl]benzoyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 164510959 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | tert-butyl 4-[4-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-2-yl]benzoyl]oxypiperidine-1-carboxylate |
| SMILES | C=C(C(=O)OC(C)(C)C)c1ccc(C(=O)OC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H33NO6/c1-16(20(26)30-23(2,3)4)17-8-10-18(11-9-17)21(27)29-19-12-14-25(15-13-19)22(28)31-24(5,6)7/h8-11,19H,1,12-15H2,2-7H3 |
| InChIKey | HVKSXYQUGLCWJZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|