C27H28N2O7 — CID 51130836
tert-butyl 4-[4-[(2-oxochromene-3-carbonyl)amino]benzoyl]oxypiperidine-1-carboxylate (PubChem CID 51130836) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2-oxochromene-3-carbonyl)amino]benzoyl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2-oxochromene-3-carbonyl)amino]benzoyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 51130836 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | tert-butyl 4-[4-[(2-oxochromene-3-carbonyl)amino]benzoyl]oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OC(=O)c2ccc(NC(=O)c3cc4ccccc4oc3=O)cc2)CC1 |
| InChI | InChI=1S/C27H28N2O7/c1-27(2,3)36-26(33)29-14-12-20(13-15-29)34-24(31)17-8-10-19(11-9-17)28-23(30)21-16-18-6-4-5-7-22(18)35-25(21)32/h4-11,16,20H,12-15H2,1-3H3,(H,28,30) |
| InChIKey | TZMYYNWUCHDDHP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|