C23H30N2O5 — CID 164580364
tert-butyl 2-tert-butyl-4-(2-oxochromene-3-carbonyl)piperazine-1-carboxylate (PubChem CID 164580364) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is tert-butyl 2-tert-butyl-4-(2-oxochromene-3-carbonyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-tert-butyl-4-(2-oxochromene-3-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 164580364 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | tert-butyl 2-tert-butyl-4-(2-oxochromene-3-carbonyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2cc3ccccc3oc2=O)CC1C(C)(C)C |
| InChI | InChI=1S/C23H30N2O5/c1-22(2,3)18-14-24(11-12-25(18)21(28)30-23(4,5)6)19(26)16-13-15-9-7-8-10-17(15)29-20(16)27/h7-10,13,18H,11-12,14H2,1-6H3 |
| InChIKey | ZJGVGMKTMQUEOZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|