C9H6N4O — CID 67086400
6-amino-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile (PubChem CID 67086400) has the molecular formula C9H6N4O and a molecular weight of 186.17 g/mol. Its IUPAC name is 6-amino-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile.
| Compound Name | 6-amino-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67086400 |
| Molecular Formula | C9H6N4O |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 6-amino-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(N)c(-c2ncco2)c1 |
| InChI | InChI=1S/C9H6N4O/c10-4-6-3-7(8(11)13-5-6)9-12-1-2-14-9/h1-3,5H,(H2,11,13) |
| InChIKey | BEAZSVRBMHXEPB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |