C20H18ClFN2O6 — CID 67087705
dimethyl 2-[5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-2-oxo-1H-indol-3-yl]propanedioate (PubChem CID 67087705) has the molecular formula C20H18ClFN2O6 and a molecular weight of 436.82 g/mol. Its IUPAC name is dimethyl 2-[5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-2-oxo-1H-indol-3-yl]propanedioate.
| Compound Name | dimethyl 2-[5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-2-oxo-1H-indol-3-yl]propanedioate |
|---|---|
| PubChem CID | 67087705 |
| Molecular Formula | C20H18ClFN2O6 |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | dimethyl 2-[5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-2-oxo-1H-indol-3-yl]propanedioate |
| SMILES | CCOc1ncccc1C1(C(C(=O)OC)C(=O)OC)C(=O)Nc2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C20H18ClFN2O6/c1-4-30-16-10(6-5-7-23-16)20(15(17(25)28-2)18(26)29-3)11-8-12(21)13(22)9-14(11)24-19(20)27/h5-9,15H,4H2,1-3H3,(H,24,27) |
| InChIKey | ZBLNARZXJZELOU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|