C27H29ClFN5O2 — CID 67199170
5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-1H-indol-2-one (PubChem CID 67199170) has the molecular formula C27H29ClFN5O2 and a molecular weight of 510.01 g/mol. Its IUPAC name is 5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-1H-indol-2-one.
| Compound Name | 5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-1H-indol-2-one |
|---|---|
| PubChem CID | 67199170 |
| Molecular Formula | C27H29ClFN5O2 |
| Molecular Weight | 510.01 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-1H-indol-2-one |
| SMILES | CCOc1ncccc1C1(NCc2ccc(N3CCN(C)CC3)cc2)C(=O)Nc2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C27H29ClFN5O2/c1-3-36-25-20(5-4-10-30-25)27(21-15-22(28)23(29)16-24(21)32-26(27)35)31-17-18-6-8-19(9-7-18)34-13-11-33(2)12-14-34/h4-10,15-16,31H,3,11-14,17H2,1-2H3,(H,32,35) |
| InChIKey | DNNZWUHZAHRMET-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.01 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|