C28H30N6O2 — CID 67193784
3-(2-ethoxy-3-pyridinyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-2-oxo-1H-indole-5-carbonitrile (PubChem CID 67193784) has the molecular formula C28H30N6O2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 3-(2-ethoxy-3-pyridinyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-2-oxo-1H-indole-5-carbonitrile.
| Compound Name | 3-(2-ethoxy-3-pyridinyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-2-oxo-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 67193784 |
| Molecular Formula | C28H30N6O2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 3-(2-ethoxy-3-pyridinyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-2-oxo-1H-indole-5-carbonitrile |
| SMILES | CCOc1ncccc1C1(NCc2ccc(N3CCN(C)CC3)cc2)C(=O)Nc2ccc(C#N)cc21 |
| InChI | InChI=1S/C28H30N6O2/c1-3-36-26-23(5-4-12-30-26)28(24-17-21(18-29)8-11-25(24)32-27(28)35)31-19-20-6-9-22(10-7-20)34-15-13-33(2)14-16-34/h4-12,17,31H,3,13-16,19H2,1-2H3,(H,32,35) |
| InChIKey | SFKPOLCQAQILBO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|