C33H33ClFN5O5S — CID 67195326
5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-1-(4-methoxyphenyl)sulfonyl-3-[4-(4-methylpiperazin-1-yl)anilino]indol-2-one (PubChem CID 67195326) has the molecular formula C33H33ClFN5O5S and a molecular weight of 666.18 g/mol. Its IUPAC name is 5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-1-(4-methoxyphenyl)sulfonyl-3-[4-(4-methylpiperazin-1-yl)anilino]indol-2-one.
| Compound Name | 5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-1-(4-methoxyphenyl)sulfonyl-3-[4-(4-methylpiperazin-1-yl)anilino]indol-2-one |
|---|---|
| PubChem CID | 67195326 |
| Molecular Formula | C33H33ClFN5O5S |
| Molecular Weight | 666.18 g/mol |
| Exact Mass | 665.19 |
| IUPAC Name | 5-chloro-3-(2-ethoxy-3-pyridinyl)-6-fluoro-1-(4-methoxyphenyl)sulfonyl-3-[4-(4-methylpiperazin-1-yl)anilino]indol-2-one |
| SMILES | CCOc1ncccc1C1(Nc2ccc(N3CCN(C)CC3)cc2)C(=O)N(S(=O)(=O)c2ccc(OC)cc2)c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C33H33ClFN5O5S/c1-4-45-31-26(6-5-15-36-31)33(37-22-7-9-23(10-8-22)39-18-16-38(2)17-19-39)27-20-28(34)29(35)21-30(27)40(32(33)41)46(42,43)25-13-11-24(44-3)12-14-25/h5-15,20-21,37H,4,16-19H2,1-3H3 |
| InChIKey | ZBEQGUGNKNOTLU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|