C26H22F3NO6 — CID 67088277
2-[4-[4-(difluoromethoxy)-1,3-dioxo-9-propoxybenzo[f]isoindol-2-yl]-3-fluorophenyl]butanoic acid (PubChem CID 67088277) has the molecular formula C26H22F3NO6 and a molecular weight of 501.46 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethoxy)-1,3-dioxo-9-propoxybenzo[f]isoindol-2-yl]-3-fluorophenyl]butanoic acid.
| Compound Name | 2-[4-[4-(difluoromethoxy)-1,3-dioxo-9-propoxybenzo[f]isoindol-2-yl]-3-fluorophenyl]butanoic acid |
|---|---|
| PubChem CID | 67088277 |
| Molecular Formula | C26H22F3NO6 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-[4-[4-(difluoromethoxy)-1,3-dioxo-9-propoxybenzo[f]isoindol-2-yl]-3-fluorophenyl]butanoic acid |
| SMILES | CCCOc1c2c(c(OC(F)F)c3ccccc13)C(=O)N(c1ccc(C(CC)C(=O)O)cc1F)C2=O |
| InChI | InChI=1S/C26H22F3NO6/c1-3-11-35-21-15-7-5-6-8-16(15)22(36-26(28)29)20-19(21)23(31)30(24(20)32)18-10-9-13(12-17(18)27)14(4-2)25(33)34/h5-10,12,14,26H,3-4,11H2,1-2H3,(H,33,34) |
| InChIKey | RAWLPXWICSHAFK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|