C25H29N5O3 — CID 67089983
tert-butyl N-[4-[4-[(E)-2-(1H-indazol-3-yl)ethenyl]benzoyl]piperazin-1-yl]carbamate (PubChem CID 67089983) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[(E)-2-(1H-indazol-3-yl)ethenyl]benzoyl]piperazin-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[(E)-2-(1H-indazol-3-yl)ethenyl]benzoyl]piperazin-1-yl]carbamate |
|---|---|
| PubChem CID | 67089983 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | tert-butyl N-[4-[4-[(E)-2-(1H-indazol-3-yl)ethenyl]benzoyl]piperazin-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NN1CCN(C(=O)c2ccc(/C=C/c3n[nH]c4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C25H29N5O3/c1-25(2,3)33-24(32)28-30-16-14-29(15-17-30)23(31)19-11-8-18(9-12-19)10-13-22-20-6-4-5-7-21(20)26-27-22/h4-13H,14-17H2,1-3H3,(H,26,27)(H,28,32)/b13-10+ |
| InChIKey | KTZCJFZLYRAQDT-JLHYYAGUSA-N |
| XLogP | 3.93 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |