C25H27ClN4O3 — CID 67090039
tert-butyl 4-[2-chloro-4-[2-(1H-indazol-3-yl)ethenyl]benzoyl]piperazine-1-carboxylate (PubChem CID 67090039) has the molecular formula C25H27ClN4O3 and a molecular weight of 466.97 g/mol. Its IUPAC name is tert-butyl 4-[2-chloro-4-[2-(1H-indazol-3-yl)ethenyl]benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-chloro-4-[2-(1H-indazol-3-yl)ethenyl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67090039 |
| Molecular Formula | C25H27ClN4O3 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | tert-butyl 4-[2-chloro-4-[2-(1H-indazol-3-yl)ethenyl]benzoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2ccc(C=Cc3n[nH]c4ccccc34)cc2Cl)CC1 |
| InChI | InChI=1S/C25H27ClN4O3/c1-25(2,3)33-24(32)30-14-12-29(13-15-30)23(31)18-10-8-17(16-20(18)26)9-11-22-19-6-4-5-7-21(19)27-28-22/h4-11,16H,12-15H2,1-3H3,(H,27,28) |
| InChIKey | PSTGZJWHZUVKLN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |