C32H45N3O8S — CID 67092119
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[(2,2-dimethyl-5-oxohexyl)-[3-(methylamino)phenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 67092119) has the molecular formula C32H45N3O8S and a molecular weight of 631.79 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[(2,2-dimethyl-5-oxohexyl)-[3-(methylamino)phenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[(2,2-dimethyl-5-oxohexyl)-[3-(methylamino)phenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67092119 |
| Molecular Formula | C32H45N3O8S |
| Molecular Weight | 631.79 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[(2,2-dimethyl-5-oxohexyl)-[3-(methylamino)phenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CNc1cccc(S(=O)(=O)N(C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COC3OCCC23)CC(C)(C)CCC(C)=O)c1 |
| InChI | InChI=1S/C32H45N3O8S/c1-22(36)13-15-32(2,3)21-35(44(39,40)25-12-8-11-24(18-25)33-4)19-28(37)27(17-23-9-6-5-7-10-23)34-31(38)43-29-20-42-30-26(29)14-16-41-30/h5-12,18,26-30,33,37H,13-17,19-21H2,1-4H3,(H,34,38)/t26?,27-,28+,29?,30?/m0/s1 |
| InChIKey | CNLROKJXHVZTBB-BEDMSCRJSA-N |
| XLogP | 3.57 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |