C23H23N3O2 — CID 67096152
(1R)-1-[1-[3-(2,3-dimethoxyphenyl)phenyl]benzimidazol-5-yl]ethanamine (PubChem CID 67096152) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (1R)-1-[1-[3-(2,3-dimethoxyphenyl)phenyl]benzimidazol-5-yl]ethanamine.
| Compound Name | (1R)-1-[1-[3-(2,3-dimethoxyphenyl)phenyl]benzimidazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 67096152 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (1R)-1-[1-[3-(2,3-dimethoxyphenyl)phenyl]benzimidazol-5-yl]ethanamine |
| SMILES | COc1cccc(-c2cccc(-n3cnc4cc([C@@H](C)N)ccc43)c2)c1OC |
| InChI | InChI=1S/C23H23N3O2/c1-15(24)16-10-11-21-20(13-16)25-14-26(21)18-7-4-6-17(12-18)19-8-5-9-22(27-2)23(19)28-3/h4-15H,24H2,1-3H3/t15-/m1/s1 |
| InChIKey | YOSFSEAGAQAXBO-OAHLLOKOSA-N |
| XLogP | 4.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |