C21H19N3 — CID 16660556
1-[1-(3-phenylphenyl)benzimidazol-5-yl]ethanamine (PubChem CID 16660556) has the molecular formula C21H19N3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[1-(3-phenylphenyl)benzimidazol-5-yl]ethanamine.
| Compound Name | 1-[1-(3-phenylphenyl)benzimidazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 16660556 |
| Molecular Formula | C21H19N3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-[1-(3-phenylphenyl)benzimidazol-5-yl]ethanamine |
| SMILES | CC(N)c1ccc2c(c1)ncn2-c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H19N3/c1-15(22)17-10-11-21-20(13-17)23-14-24(21)19-9-5-8-18(12-19)16-6-3-2-4-7-16/h2-15H,22H2,1H3 |
| InChIKey | CJKRCJXOIXCMQV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |