C21H16ClF2N3 — CID 67095912
(1R)-1-[1-[3-(3-chloro-2,6-difluorophenyl)phenyl]benzimidazol-5-yl]ethanamine (PubChem CID 67095912) has the molecular formula C21H16ClF2N3 and a molecular weight of 383.83 g/mol. Its IUPAC name is (1R)-1-[1-[3-(3-chloro-2,6-difluorophenyl)phenyl]benzimidazol-5-yl]ethanamine.
| Compound Name | (1R)-1-[1-[3-(3-chloro-2,6-difluorophenyl)phenyl]benzimidazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 67095912 |
| Molecular Formula | C21H16ClF2N3 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | (1R)-1-[1-[3-(3-chloro-2,6-difluorophenyl)phenyl]benzimidazol-5-yl]ethanamine |
| SMILES | C[C@@H](N)c1ccc2c(c1)ncn2-c1cccc(-c2c(F)ccc(Cl)c2F)c1 |
| InChI | InChI=1S/C21H16ClF2N3/c1-12(25)13-5-8-19-18(10-13)26-11-27(19)15-4-2-3-14(9-15)20-17(23)7-6-16(22)21(20)24/h2-12H,25H2,1H3/t12-/m1/s1 |
| InChIKey | OJWJWXOLHNSREK-GFCCVEGCSA-N |
| XLogP | 5.64 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|