C21H17N5 — CID 46205030
3-[3-[5-[(1R)-1-aminoethyl]benzimidazol-1-yl]phenyl]pyridine-4-carbonitrile (PubChem CID 46205030) has the molecular formula C21H17N5 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-[3-[5-[(1R)-1-aminoethyl]benzimidazol-1-yl]phenyl]pyridine-4-carbonitrile.
| Compound Name | 3-[3-[5-[(1R)-1-aminoethyl]benzimidazol-1-yl]phenyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 46205030 |
| Molecular Formula | C21H17N5 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-[3-[5-[(1R)-1-aminoethyl]benzimidazol-1-yl]phenyl]pyridine-4-carbonitrile |
| SMILES | C[C@@H](N)c1ccc2c(c1)ncn2-c1cccc(-c2cnccc2C#N)c1 |
| InChI | InChI=1S/C21H17N5/c1-14(23)15-5-6-21-20(10-15)25-13-26(21)18-4-2-3-16(9-18)19-12-24-8-7-17(19)11-22/h2-10,12-14H,23H2,1H3/t14-/m1/s1 |
| InChIKey | MMCZIMOZVQUTDV-CQSZACIVSA-N |
| XLogP | 3.98 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |