C12H9BrN2O2S — CID 67096905
2-(2-bromo-4-ethoxyphenoxy)-1,3-thiazole-5-carbonitrile (PubChem CID 67096905) has the molecular formula C12H9BrN2O2S and a molecular weight of 325.19 g/mol. Its IUPAC name is 2-(2-bromo-4-ethoxyphenoxy)-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-(2-bromo-4-ethoxyphenoxy)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 67096905 |
| Molecular Formula | C12H9BrN2O2S |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 2-(2-bromo-4-ethoxyphenoxy)-1,3-thiazole-5-carbonitrile |
| SMILES | CCOc1ccc(Oc2ncc(C#N)s2)c(Br)c1 |
| InChI | InChI=1S/C12H9BrN2O2S/c1-2-16-8-3-4-11(10(13)5-8)17-12-15-7-9(6-14)18-12/h3-5,7H,2H2,1H3 |
| InChIKey | AACCXOQXTNMJOF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |