About 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine
4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine (PubChem CID 67100453) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine.
Analyze 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine?
The IUPAC name of 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine (CID 67100453) is 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine.
What is the SMILES notation for 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine?
The canonical SMILES for 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine is CC1N=CCC2SC=CC12.
What is the InChIKey of 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine?
The InChIKey is GTFWOLVOKZVCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-6-7-3-5-10-8(7)2-4-9-6/h3-8H,2H2,1H3.
What are the key properties of 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine?
4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine has a molecular weight of 153.25 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3a,4,7,7a-tetrahydrothieno[3,2-c]pyridine is sourced from PubChem (CID 67100453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).