C9H13NS — CID 123767400
5-methylsulfanyl-3,3a,4,5-tetrahydro-2H-indole (PubChem CID 123767400) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is 5-methylsulfanyl-3,3a,4,5-tetrahydro-2H-indole.
| Compound Name | 5-methylsulfanyl-3,3a,4,5-tetrahydro-2H-indole |
|---|---|
| PubChem CID | 123767400 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 5-methylsulfanyl-3,3a,4,5-tetrahydro-2H-indole |
| SMILES | CSC1C=CC2=NCCC2C1 |
| InChI | InChI=1S/C9H13NS/c1-11-8-2-3-9-7(6-8)4-5-10-9/h2-3,7-8H,4-6H2,1H3 |
| InChIKey | DQLMRDGOLRCRTE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |