About N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine
N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine (PubChem CID 91182831) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine.
Molecular Properties
| Compound Name | N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine |
| PubChem CID | 91182831 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine |
| SMILES | CC/N=C1\CSC2CC=CC12 |
| InChI | InChI=1S/C9H13NS/c1-2-10-8-6-11-9-5-3-4-7(8)9/h3-4,7,9H,2,5-6H2,1H3/b10-8+ |
| InChIKey | KHHYXEFWIKZYQN-CSKARUKUSA-N |
| XLogP | 2.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine?
The IUPAC name of N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine (CID 91182831) is N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine.
What is the SMILES notation for N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine?
The canonical SMILES for N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine is CC/N=C1\CSC2CC=CC12.
What is the InChIKey of N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine?
The InChIKey is KHHYXEFWIKZYQN-CSKARUKUSA-N. The full InChI is InChI=1S/C9H13NS/c1-2-10-8-6-11-9-5-3-4-7(8)9/h3-4,7,9H,2,5-6H2,1H3/b10-8+.
What are the key properties of N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine?
N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine has a molecular weight of 167.28 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6,6a-dihydro-3aH-cyclopenta[b]thiophen-3-imine is sourced from PubChem (CID 91182831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).