About ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate
ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate (PubChem CID 67106194) has the molecular formula C24H21N3O5
and a molecular weight of 431.45 g/mol. Its IUPAC name is ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate |
| PubChem CID | 67106194 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccccc2C=CC(=O)CC(=O)C=Cc2ccc(O)cc2)nn1 |
| InChI | InChI=1S/C24H21N3O5/c1-2-32-24(31)22-16-27(26-25-22)23-6-4-3-5-18(23)10-14-21(30)15-20(29)13-9-17-7-11-19(28)12-8-17/h3-14,16,28H,2,15H2,1H3 |
| InChIKey | IWJTWIOWCLFFMC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate?
The IUPAC name of ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate (CID 67106194) is ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate.
What is the SMILES notation for ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate?
The canonical SMILES for ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate is CCOC(=O)c1cn(-c2ccccc2C=CC(=O)CC(=O)C=Cc2ccc(O)cc2)nn1.
What is the InChIKey of ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate?
The InChIKey is IWJTWIOWCLFFMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O5/c1-2-32-24(31)22-16-27(26-25-22)23-6-4-3-5-18(23)10-14-21(30)15-20(29)13-9-17-7-11-19(28)12-8-17/h3-14,16,28H,2,15H2,1H3.
What are the key properties of ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate?
ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate has a molecular weight of 431.45 g/mol, XLogP of 3.40, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate is sourced from PubChem (CID 67106194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).