C24H21N3O5 — CID 67106194
ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate (PubChem CID 67106194) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate.
| Compound Name | ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 67106194 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | ethyl 1-[2-[7-(4-hydroxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccccc2C=CC(=O)CC(=O)C=Cc2ccc(O)cc2)nn1 |
| InChI | InChI=1S/C24H21N3O5/c1-2-32-24(31)22-16-27(26-25-22)23-6-4-3-5-18(23)10-14-21(30)15-20(29)13-9-17-7-11-19(28)12-8-17/h3-14,16,28H,2,15H2,1H3 |
| InChIKey | IWJTWIOWCLFFMC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|