C23H22O2S — CID 67108847
1-(1,2-diphenylethenylsulfanylmethyl)-3,5-dimethoxybenzene (PubChem CID 67108847) has the molecular formula C23H22O2S and a molecular weight of 362.49 g/mol. Its IUPAC name is 1-(1,2-diphenylethenylsulfanylmethyl)-3,5-dimethoxybenzene.
| Compound Name | 1-(1,2-diphenylethenylsulfanylmethyl)-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 67108847 |
| Molecular Formula | C23H22O2S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-(1,2-diphenylethenylsulfanylmethyl)-3,5-dimethoxybenzene |
| SMILES | COc1cc(CSC(=Cc2ccccc2)c2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C23H22O2S/c1-24-21-13-19(14-22(16-21)25-2)17-26-23(20-11-7-4-8-12-20)15-18-9-5-3-6-10-18/h3-16H,17H2,1-2H3 |
| InChIKey | QABXWXAKGFEGIM-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|