C46H43ClO3 — CID 159192069
1-[2-chloro-4-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]but-2-enyl]-4-methoxybenzene;1,2-diphenylethenylbenzene (PubChem CID 159192069) has the molecular formula C46H43ClO3 and a molecular weight of 679.30 g/mol. Its IUPAC name is 1-[2-chloro-4-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]but-2-enyl]-4-methoxybenzene;1,2-diphenylethenylbenzene.
| Compound Name | 1-[2-chloro-4-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]but-2-enyl]-4-methoxybenzene;1,2-diphenylethenylbenzene |
|---|---|
| PubChem CID | 159192069 |
| Molecular Formula | C46H43ClO3 |
| Molecular Weight | 679.30 g/mol |
| Exact Mass | 678.29 |
| IUPAC Name | 1-[2-chloro-4-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]but-2-enyl]-4-methoxybenzene;1,2-diphenylethenylbenzene |
| SMILES | C(=C(c1ccccc1)c1ccccc1)c1ccccc1.COc1ccc(CC(Cl)=C(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H27ClO3.C20H16/c1-28-23-10-4-19(5-11-23)16-22(17-20-6-12-24(29-2)13-7-20)26(27)18-21-8-14-25(30-3)15-9-21;1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h4-15H,16-18H2,1-3H3;1-16H |
| InChIKey | KOFDGFQMRFNCJC-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.30 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|