C22H20O2S — CID 135066313
1-[(E)-1,2-diphenylethenyl]-4-methoxy-2-methylsulfinylbenzene (PubChem CID 135066313) has the molecular formula C22H20O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-[(E)-1,2-diphenylethenyl]-4-methoxy-2-methylsulfinylbenzene.
| Compound Name | 1-[(E)-1,2-diphenylethenyl]-4-methoxy-2-methylsulfinylbenzene |
|---|---|
| PubChem CID | 135066313 |
| Molecular Formula | C22H20O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-[(E)-1,2-diphenylethenyl]-4-methoxy-2-methylsulfinylbenzene |
| SMILES | COc1ccc(/C(=C/c2ccccc2)c2ccccc2)c(S(C)=O)c1 |
| InChI | InChI=1S/C22H20O2S/c1-24-19-13-14-20(22(16-19)25(2)23)21(18-11-7-4-8-12-18)15-17-9-5-3-6-10-17/h3-16H,1-2H3/b21-15+ |
| InChIKey | BAMYGOCYKNKXPN-RCCKNPSSSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|