C18H18N4O6S2 — CID 67109307
2-[2-ethyl-2-[7-[methyl(thiophen-2-ylsulfonyl)amino]-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetic acid (PubChem CID 67109307) has the molecular formula C18H18N4O6S2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[2-ethyl-2-[7-[methyl(thiophen-2-ylsulfonyl)amino]-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetic acid.
| Compound Name | 2-[2-ethyl-2-[7-[methyl(thiophen-2-ylsulfonyl)amino]-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67109307 |
| Molecular Formula | C18H18N4O6S2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 2-[2-ethyl-2-[7-[methyl(thiophen-2-ylsulfonyl)amino]-1H-indole-2-carbonyl]hydrazinyl]-2-oxoacetic acid |
| SMILES | CCN(NC(=O)C(=O)O)C(=O)c1cc2cccc(N(C)S(=O)(=O)c3cccs3)c2[nH]1 |
| InChI | InChI=1S/C18H18N4O6S2/c1-3-22(20-16(23)18(25)26)17(24)12-10-11-6-4-7-13(15(11)19-12)21(2)30(27,28)14-8-5-9-29-14/h4-10,19H,3H2,1-2H3,(H,20,23)(H,25,26) |
| InChIKey | KZBDGHSDIUHSRU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|