C27H31N3O5S3 — CID 59135744
N-(2-benzylsulfanyl-3,3-dimethoxypropyl)-4-methyl-7-[methyl(thiophen-2-ylsulfonyl)amino]-1H-indole-2-carboxamide (PubChem CID 59135744) has the molecular formula C27H31N3O5S3 and a molecular weight of 573.76 g/mol. Its IUPAC name is N-(2-benzylsulfanyl-3,3-dimethoxypropyl)-4-methyl-7-[methyl(thiophen-2-ylsulfonyl)amino]-1H-indole-2-carboxamide.
| Compound Name | N-(2-benzylsulfanyl-3,3-dimethoxypropyl)-4-methyl-7-[methyl(thiophen-2-ylsulfonyl)amino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 59135744 |
| Molecular Formula | C27H31N3O5S3 |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | N-(2-benzylsulfanyl-3,3-dimethoxypropyl)-4-methyl-7-[methyl(thiophen-2-ylsulfonyl)amino]-1H-indole-2-carboxamide |
| SMILES | COC(OC)C(CNC(=O)c1cc2c(C)ccc(N(C)S(=O)(=O)c3cccs3)c2[nH]1)SCc1ccccc1 |
| InChI | InChI=1S/C27H31N3O5S3/c1-18-12-13-22(30(2)38(32,33)24-11-8-14-36-24)25-20(18)15-21(29-25)26(31)28-16-23(27(34-3)35-4)37-17-19-9-6-5-7-10-19/h5-15,23,27,29H,16-17H2,1-4H3,(H,28,31) |
| InChIKey | JBBHUGUPRHXTHA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|