C22H21N3O3S3 — CID 70883569
N-(2-benzylsulfanylethyl)-7-(thiophen-2-ylsulfonylamino)-1H-indole-2-carboxamide (PubChem CID 70883569) has the molecular formula C22H21N3O3S3 and a molecular weight of 471.63 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-7-(thiophen-2-ylsulfonylamino)-1H-indole-2-carboxamide.
| Compound Name | N-(2-benzylsulfanylethyl)-7-(thiophen-2-ylsulfonylamino)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70883569 |
| Molecular Formula | C22H21N3O3S3 |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-7-(thiophen-2-ylsulfonylamino)-1H-indole-2-carboxamide |
| SMILES | O=C(NCCSCc1ccccc1)c1cc2cccc(NS(=O)(=O)c3cccs3)c2[nH]1 |
| InChI | InChI=1S/C22H21N3O3S3/c26-22(23-11-13-29-15-16-6-2-1-3-7-16)19-14-17-8-4-9-18(21(17)24-19)25-31(27,28)20-10-5-12-30-20/h1-10,12,14,24-25H,11,13,15H2,(H,23,26) |
| InChIKey | LOUPHLBRKUFPEC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|