C22H19N3O3S2 — CID 24628570
N-(2-pyridin-2-ylethyl)-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide (PubChem CID 24628570) has the molecular formula C22H19N3O3S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is N-(2-pyridin-2-ylethyl)-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide.
| Compound Name | N-(2-pyridin-2-ylethyl)-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 24628570 |
| Molecular Formula | C22H19N3O3S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | N-(2-pyridin-2-ylethyl)-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide |
| SMILES | O=C(NCCc1ccccn1)c1cc2ccccc2cc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C22H19N3O3S2/c26-22(24-12-10-18-8-3-4-11-23-18)19-14-16-6-1-2-7-17(16)15-20(19)25-30(27,28)21-9-5-13-29-21/h1-9,11,13-15,25H,10,12H2,(H,24,26) |
| InChIKey | COVLVEJOQQDSBO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |