C20H15N3O3S2 — CID 18271825
N-pyridin-2-yl-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide (PubChem CID 18271825) has the molecular formula C20H15N3O3S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-pyridin-2-yl-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide.
| Compound Name | N-pyridin-2-yl-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18271825 |
| Molecular Formula | C20H15N3O3S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-pyridin-2-yl-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cc2ccccc2cc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H15N3O3S2/c24-20(22-18-8-3-4-10-21-18)16-12-14-6-1-2-7-15(14)13-17(16)23-28(25,26)19-9-5-11-27-19/h1-13,23H,(H,21,22,24) |
| InChIKey | WIENSOSFGFPOMN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |