C22H18N2O4S2 — CID 18283850
N-phenylmethoxy-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide (PubChem CID 18283850) has the molecular formula C22H18N2O4S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-phenylmethoxy-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide.
| Compound Name | N-phenylmethoxy-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18283850 |
| Molecular Formula | C22H18N2O4S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-phenylmethoxy-3-(thiophen-2-ylsulfonylamino)naphthalene-2-carboxamide |
| SMILES | O=C(NOCc1ccccc1)c1cc2ccccc2cc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C22H18N2O4S2/c25-22(23-28-15-16-7-2-1-3-8-16)19-13-17-9-4-5-10-18(17)14-20(19)24-30(26,27)21-11-6-12-29-21/h1-14,24H,15H2,(H,23,25) |
| InChIKey | KJNQCPZMLNGMSY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|