C24H21N3O5S2 — CID 24664130
N-[3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]naphthalen-2-yl]thiophene-2-sulfonamide (PubChem CID 24664130) has the molecular formula C24H21N3O5S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]naphthalen-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]naphthalen-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 24664130 |
| Molecular Formula | C24H21N3O5S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | N-[3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]naphthalen-2-yl]thiophene-2-sulfonamide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)c2cc3ccccc3cc2NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C24H21N3O5S2/c1-16-6-4-9-19(12-16)32-15-22(28)25-26-24(29)20-13-17-7-2-3-8-18(17)14-21(20)27-34(30,31)23-10-5-11-33-23/h2-14,27H,15H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | AKOPTNHLSBQGFC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|