C20H15N3O4S3 — CID 24665030
N-[3-[(thiophene-2-carbonylamino)carbamoyl]naphthalen-2-yl]thiophene-2-sulfonamide (PubChem CID 24665030) has the molecular formula C20H15N3O4S3 and a molecular weight of 457.56 g/mol. Its IUPAC name is N-[3-[(thiophene-2-carbonylamino)carbamoyl]naphthalen-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[(thiophene-2-carbonylamino)carbamoyl]naphthalen-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 24665030 |
| Molecular Formula | C20H15N3O4S3 |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | N-[3-[(thiophene-2-carbonylamino)carbamoyl]naphthalen-2-yl]thiophene-2-sulfonamide |
| SMILES | O=C(NNC(=O)c1cc2ccccc2cc1NS(=O)(=O)c1cccs1)c1cccs1 |
| InChI | InChI=1S/C20H15N3O4S3/c24-19(21-22-20(25)17-7-3-9-28-17)15-11-13-5-1-2-6-14(13)12-16(15)23-30(26,27)18-8-4-10-29-18/h1-12,23H,(H,21,24)(H,22,25) |
| InChIKey | YGRLVRCAXSVRCU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|