C28H42N4O2 — CID 67109365
N-[1-cyclohexyl-2-oxo-2-[7-(2-phenylethyl)-2,3,3a,4,5,6-hexahydropyrrolo[2,3-c]azepin-1-yl]ethyl]-2-(methylamino)propanamide (PubChem CID 67109365) has the molecular formula C28H42N4O2 and a molecular weight of 466.67 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-oxo-2-[7-(2-phenylethyl)-2,3,3a,4,5,6-hexahydropyrrolo[2,3-c]azepin-1-yl]ethyl]-2-(methylamino)propanamide.
| Compound Name | N-[1-cyclohexyl-2-oxo-2-[7-(2-phenylethyl)-2,3,3a,4,5,6-hexahydropyrrolo[2,3-c]azepin-1-yl]ethyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 67109365 |
| Molecular Formula | C28H42N4O2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | N-[1-cyclohexyl-2-oxo-2-[7-(2-phenylethyl)-2,3,3a,4,5,6-hexahydropyrrolo[2,3-c]azepin-1-yl]ethyl]-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2CCCN(CCc3ccccc3)C=C21)C1CCCCC1 |
| InChI | InChI=1S/C28H42N4O2/c1-21(29-2)27(33)30-26(24-12-7-4-8-13-24)28(34)32-19-16-23-14-9-17-31(20-25(23)32)18-15-22-10-5-3-6-11-22/h3,5-6,10-11,20-21,23-24,26,29H,4,7-9,12-19H2,1-2H3,(H,30,33) |
| InChIKey | OULQURPDSPQLJO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |