C27H44N4O — CID 167077695
(2S)-N-[(1S)-2-[(3aR,7aS)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-1-cyclohexylethyl]-2-(methylamino)propanamide (PubChem CID 167077695) has the molecular formula C27H44N4O and a molecular weight of 440.68 g/mol. Its IUPAC name is (2S)-N-[(1S)-2-[(3aR,7aS)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-1-cyclohexylethyl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(1S)-2-[(3aR,7aS)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-1-cyclohexylethyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 167077695 |
| Molecular Formula | C27H44N4O |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | (2S)-N-[(1S)-2-[(3aR,7aS)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-1-cyclohexylethyl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H](CN1CC[C@H]2CCN(CCc3ccccc3)C[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C27H44N4O/c1-21(28-2)27(32)29-25(23-11-7-4-8-12-23)19-31-18-15-24-14-17-30(20-26(24)31)16-13-22-9-5-3-6-10-22/h3,5-6,9-10,21,23-26,28H,4,7-8,11-20H2,1-2H3,(H,29,32)/t21-,24+,25+,26+/m0/s1 |
| InChIKey | JEVSFQOCTUZRAU-XJXBIZEQSA-N |
| XLogP | 3.30 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |