C28H44N4O2 — CID 140529602
(3S)-4-[(3aR,7aS)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-3-cyclohexyl-2-ethyl-2-(methylamino)-4-oxobutanamide (PubChem CID 140529602) has the molecular formula C28H44N4O2 and a molecular weight of 468.69 g/mol. Its IUPAC name is (3S)-4-[(3aR,7aS)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-3-cyclohexyl-2-ethyl-2-(methylamino)-4-oxobutanamide.
| Compound Name | (3S)-4-[(3aR,7aS)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-3-cyclohexyl-2-ethyl-2-(methylamino)-4-oxobutanamide |
|---|---|
| PubChem CID | 140529602 |
| Molecular Formula | C28H44N4O2 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | (3S)-4-[(3aR,7aS)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-3-cyclohexyl-2-ethyl-2-(methylamino)-4-oxobutanamide |
| SMILES | CCC(NC)(C(N)=O)[C@@H](C(=O)N1CC[C@H]2CCN(CCc3ccccc3)C[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C28H44N4O2/c1-3-28(30-2,27(29)34)25(23-12-8-5-9-13-23)26(33)32-19-16-22-15-18-31(20-24(22)32)17-14-21-10-6-4-7-11-21/h4,6-7,10-11,22-25,30H,3,5,8-9,12-20H2,1-2H3,(H2,29,34)/t22-,24-,25-,28?/m1/s1 |
| InChIKey | XJIANCRJAYDZHO-NEXSRKHLSA-N |
| XLogP | 3.20 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |