C27H40N4O3 — CID 140529617
(3S)-4-[(3aS,6aS)-6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-cyclohexyl-2-ethyl-2-(methylamino)-4-oxobutanamide (PubChem CID 140529617) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is (3S)-4-[(3aS,6aS)-6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-cyclohexyl-2-ethyl-2-(methylamino)-4-oxobutanamide.
| Compound Name | (3S)-4-[(3aS,6aS)-6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-cyclohexyl-2-ethyl-2-(methylamino)-4-oxobutanamide |
|---|---|
| PubChem CID | 140529617 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (3S)-4-[(3aS,6aS)-6-oxo-5-(2-phenylethyl)-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-cyclohexyl-2-ethyl-2-(methylamino)-4-oxobutanamide |
| SMILES | CCC(NC)(C(N)=O)[C@@H](C(=O)N1CC[C@H]2CN(CCc3ccccc3)C(=O)[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C27H40N4O3/c1-3-27(29-2,26(28)34)22(20-12-8-5-9-13-20)24(32)31-17-15-21-18-30(25(33)23(21)31)16-14-19-10-6-4-7-11-19/h4,6-7,10-11,20-23,29H,3,5,8-9,12-18H2,1-2H3,(H2,28,34)/t21-,22+,23-,27?/m0/s1 |
| InChIKey | CFRNYWVLRWPXKD-IQIGHWHNSA-N |
| XLogP | 2.34 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |